C16H21NO2 — CID 82121250
1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone (PubChem CID 82121250) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 82121250 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C16H21NO2/c1-11-4-5-15(12(2)10-11)16(19)14-6-8-17(9-7-14)13(3)18/h4-5,10,14H,6-9H2,1-3H3 |
| InChIKey | YJNZWZOHLSIDGH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |