C21H26ClN3O3S — CID 46560526
2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide (PubChem CID 46560526) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 46560526 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide |
| SMILES | CC(c1ccccc1)N(C)C(=O)CN1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H26ClN3O3S/c1-17(18-7-4-3-5-8-18)23(2)21(26)16-24-11-13-25(14-12-24)29(27,28)20-10-6-9-19(22)15-20/h3-10,15,17H,11-14,16H2,1-2H3 |
| InChIKey | OBDQPURIFRAUSA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |