C20H22F3N3O3S — CID 27183288
N-methyl-N-phenyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 27183288) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is N-methyl-N-phenyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-methyl-N-phenyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27183288 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-methyl-N-phenyl-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | CN(C(=O)CN1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H22F3N3O3S/c1-24(17-7-3-2-4-8-17)19(27)15-25-10-12-26(13-11-25)30(28,29)18-9-5-6-16(14-18)20(21,22)23/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | UNKCXUAWCFSTIX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |