C19H23F2N3O2S — CID 35315029
4-[bis(4-fluorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 35315029) has the molecular formula C19H23F2N3O2S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[bis(4-fluorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 35315029 |
| Molecular Formula | C19H23F2N3O2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H23F2N3O2S/c1-22(2)27(25,26)24-13-11-23(12-14-24)19(15-3-7-17(20)8-4-15)16-5-9-18(21)10-6-16/h3-10,19H,11-14H2,1-2H3 |
| InChIKey | FEBPNYNMEHDRGU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |