C26H24F2N2O4S — CID 45299655
(E)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid (PubChem CID 45299655) has the molecular formula C26H24F2N2O4S and a molecular weight of 498.55 g/mol. Its IUPAC name is (E)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 45299655 |
| Molecular Formula | C26H24F2N2O4S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (E)-3-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H24F2N2O4S/c27-22-8-4-20(5-9-22)26(21-6-10-23(28)11-7-21)29-15-17-30(18-16-29)35(33,34)24-12-1-19(2-13-24)3-14-25(31)32/h1-14,26H,15-18H2,(H,31,32)/b14-3+ |
| InChIKey | ZJFFBHWUZGJAQD-LZWSPWQCSA-N |
| XLogP | 4.16 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|