C20H21FN2O3S2 — CID 8924675
(E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 8924675) has the molecular formula C20H21FN2O3S2 and a molecular weight of 420.53 g/mol. Its IUPAC name is (E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8924675 |
| Molecular Formula | C20H21FN2O3S2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21FN2O3S2/c1-27-18-7-2-16(3-8-18)4-11-20(24)22-12-14-23(15-13-22)28(25,26)19-9-5-17(21)6-10-19/h2-11H,12-15H2,1H3/b11-4+ |
| InChIKey | UPFPZHNHLYJWML-NYYWCZLTSA-N |
| XLogP | 3.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|