C18H19FN2O3S2 — CID 9496569
(E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 9496569) has the molecular formula C18H19FN2O3S2 and a molecular weight of 394.49 g/mol. Its IUPAC name is (E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9496569 |
| Molecular Formula | C18H19FN2O3S2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (E)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccsc1/C=C/C(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H19FN2O3S2/c1-14-8-13-25-17(14)6-7-18(22)20-9-11-21(12-10-20)26(23,24)16-4-2-15(19)3-5-16/h2-8,13H,9-12H2,1H3/b7-6+ |
| InChIKey | RTNOEBXOYBCZTL-VOTSOKGWSA-N |
| XLogP | 2.74 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|