C14H20N2O3S2 — CID 33336572
N-[1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide (PubChem CID 33336572) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 33336572 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[1-[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1ccsc1/C=C/C(=O)N1CCC(NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-11-7-10-20-13(11)3-4-14(17)16-8-5-12(6-9-16)15-21(2,18)19/h3-4,7,10,12,15H,5-6,8-9H2,1-2H3/b4-3+ |
| InChIKey | KUWDPVQAUXQRHM-ONEGZZNKSA-N |
| XLogP | 1.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|