C18H23N5O3S — CID 154759251
N-[1-[3-(1-benzyltriazol-4-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide (PubChem CID 154759251) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[1-[3-(1-benzyltriazol-4-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[3-(1-benzyltriazol-4-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 154759251 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[1-[3-(1-benzyltriazol-4-yl)prop-2-enoyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(C(=O)C=Cc2cn(Cc3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C18H23N5O3S/c1-27(25,26)20-16-9-11-22(12-10-16)18(24)8-7-17-14-23(21-19-17)13-15-5-3-2-4-6-15/h2-8,14,16,20H,9-13H2,1H3 |
| InChIKey | MRNOPULNFRGORQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|