C20H20N4OS — CID 8950000
(E)-3-(1-benzyltriazol-4-yl)-1-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 8950000) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-1-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-1-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8950000 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-1-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C[C@H]1c2ccsc2CCN1C(=O)/C=C/c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C20H20N4OS/c1-15-18-10-12-26-19(18)9-11-24(15)20(25)8-7-17-14-23(22-21-17)13-16-5-3-2-4-6-16/h2-8,10,12,14-15H,9,11,13H2,1H3/b8-7+/t15-/m0/s1 |
| InChIKey | JEUGTVCDDZQZIP-KIUWMYQTSA-N |
| XLogP | 3.55 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|