C23H20N4OS2 — CID 132932925
(Z)-3-(1-benzyltriazol-4-yl)-1-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one (PubChem CID 132932925) has the molecular formula C23H20N4OS2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (Z)-3-(1-benzyltriazol-4-yl)-1-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-(1-benzyltriazol-4-yl)-1-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 132932925 |
| Molecular Formula | C23H20N4OS2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (Z)-3-(1-benzyltriazol-4-yl)-1-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\c1cn(Cc2ccccc2)nn1)N1CCc2sccc2C1c1cccs1 |
| InChI | InChI=1S/C23H20N4OS2/c28-22(9-8-18-16-26(25-24-18)15-17-5-2-1-3-6-17)27-12-10-20-19(11-14-30-20)23(27)21-7-4-13-29-21/h1-9,11,13-14,16,23H,10,12,15H2/b9-8- |
| InChIKey | XTVQYQCLWIBDEE-HJWRWDBZSA-N |
| XLogP | 4.64 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|