C22H18N4OS — CID 24568121
(E)-3-(1-benzyltriazol-4-yl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide (PubChem CID 24568121) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24568121 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-(2-thiophen-2-ylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nn1)Nc1ccccc1-c1cccs1 |
| InChI | InChI=1S/C22H18N4OS/c27-22(23-20-10-5-4-9-19(20)21-11-6-14-28-21)13-12-18-16-26(25-24-18)15-17-7-2-1-3-8-17/h1-14,16H,15H2,(H,23,27)/b13-12+ |
| InChIKey | TWJPUAFZCSXPKK-OUKQBFOZSA-N |
| XLogP | 4.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|