C19H22N2O3S2 — CID 9495877
(E)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 9495877) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (E)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9495877 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (E)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)/C=C/c3sccc3C)CC2)cc1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-15-3-5-17(6-4-15)26(23,24)21-12-10-20(11-13-21)19(22)8-7-18-16(2)9-14-25-18/h3-9,14H,10-13H2,1-2H3/b8-7+ |
| InChIKey | DQZYKTGNIKQHMD-BQYQJAHWSA-N |
| XLogP | 2.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|