C14H22N4O3S — CID 34787872
(2R)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-phenylacetamide (PubChem CID 34787872) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2R)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 34787872 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2R)-2-[4-(dimethylsulfamoyl)piperazin-1-yl]-2-phenylacetamide |
| SMILES | CN(C)S(=O)(=O)N1CCN([C@@H](C(N)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H22N4O3S/c1-16(2)22(20,21)18-10-8-17(9-11-18)13(14(15)19)12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3,(H2,15,19)/t13-/m1/s1 |
| InChIKey | IVBRMYTYQKHAMT-CYBMUJFWSA-N |
| XLogP | -0.36 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |