C23H31N3O3S — CID 40972974
(2R)-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-phenylacetamide (PubChem CID 40972974) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is (2R)-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 40972974 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (2R)-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-phenylacetamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)c(C)c1C |
| InChI | InChI=1S/C23H31N3O3S/c1-15-16(2)18(4)22(19(5)17(15)3)30(28,29)26-13-11-25(12-14-26)21(23(24)27)20-9-7-6-8-10-20/h6-10,21H,11-14H2,1-5H3,(H2,24,27)/t21-/m1/s1 |
| InChIKey | ACOAQXJDGSSSAF-OAQYLSRUSA-N |
| XLogP | 2.76 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |