C16H24FN3O2S — CID 42950771
1-[1-(4-fluorophenyl)ethyl]-4-pyrrolidin-1-ylsulfonylpiperazine (PubChem CID 42950771) has the molecular formula C16H24FN3O2S and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethyl]-4-pyrrolidin-1-ylsulfonylpiperazine.
| Compound Name | 1-[1-(4-fluorophenyl)ethyl]-4-pyrrolidin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 42950771 |
| Molecular Formula | C16H24FN3O2S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethyl]-4-pyrrolidin-1-ylsulfonylpiperazine |
| SMILES | CC(c1ccc(F)cc1)N1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C16H24FN3O2S/c1-14(15-4-6-16(17)7-5-15)18-10-12-20(13-11-18)23(21,22)19-8-2-3-9-19/h4-7,14H,2-3,8-13H2,1H3 |
| InChIKey | DAIZQPFSFWKSJA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |