C19H23FN2O2S — CID 46100949
1-(5-fluoro-2-methylphenyl)sulfonyl-4-(1-phenylethyl)piperazine (PubChem CID 46100949) has the molecular formula C19H23FN2O2S and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)sulfonyl-4-(1-phenylethyl)piperazine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)sulfonyl-4-(1-phenylethyl)piperazine |
|---|---|
| PubChem CID | 46100949 |
| Molecular Formula | C19H23FN2O2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)sulfonyl-4-(1-phenylethyl)piperazine |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23FN2O2S/c1-15-8-9-18(20)14-19(15)25(23,24)22-12-10-21(11-13-22)16(2)17-6-4-3-5-7-17/h3-9,14,16H,10-13H2,1-2H3 |
| InChIKey | SOVPVLQVKPKAEN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |