C18H18F4N2O2S — CID 112840410
1-[1-(2,6-difluorophenyl)ethyl]-4-(2,4-difluorophenyl)sulfonylpiperazine (PubChem CID 112840410) has the molecular formula C18H18F4N2O2S and a molecular weight of 402.41 g/mol. Its IUPAC name is 1-[1-(2,6-difluorophenyl)ethyl]-4-(2,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-[1-(2,6-difluorophenyl)ethyl]-4-(2,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 112840410 |
| Molecular Formula | C18H18F4N2O2S |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-[1-(2,6-difluorophenyl)ethyl]-4-(2,4-difluorophenyl)sulfonylpiperazine |
| SMILES | CC(c1c(F)cccc1F)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H18F4N2O2S/c1-12(18-14(20)3-2-4-15(18)21)23-7-9-24(10-8-23)27(25,26)17-6-5-13(19)11-16(17)22/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | MXOQLDXYIUTGDO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |