C14H14F2N2O4S3 — CID 19684927
1-(2,4-difluorophenyl)sulfonyl-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 19684927) has the molecular formula C14H14F2N2O4S3 and a molecular weight of 408.47 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 19684927 |
| Molecular Formula | C14H14F2N2O4S3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1cccs1)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H14F2N2O4S3/c15-11-3-4-13(12(16)10-11)24(19,20)17-5-7-18(8-6-17)25(21,22)14-2-1-9-23-14/h1-4,9-10H,5-8H2 |
| InChIKey | GOCSQCYQEMVIKX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |