C16H14Cl2F2N2O4S2 — CID 26947080
1-(2,6-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine (PubChem CID 26947080) has the molecular formula C16H14Cl2F2N2O4S2 and a molecular weight of 471.33 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26947080 |
| Molecular Formula | C16H14Cl2F2N2O4S2 |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H14Cl2F2N2O4S2/c17-12-2-1-3-13(18)16(12)28(25,26)22-8-6-21(7-9-22)27(23,24)15-5-4-11(19)10-14(15)20/h1-5,10H,6-9H2 |
| InChIKey | XHKFPFNFQNYLTR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |