C12H16N2O — CID 78214180
2-ethyl-6-phenyl-1,3-diazinan-4-one (PubChem CID 78214180) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-ethyl-6-phenyl-1,3-diazinan-4-one.
| Compound Name | 2-ethyl-6-phenyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78214180 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-ethyl-6-phenyl-1,3-diazinan-4-one |
| SMILES | CCC1NC(=O)CC(c2ccccc2)N1 |
| InChI | InChI=1S/C12H16N2O/c1-2-11-13-10(8-12(15)14-11)9-6-4-3-5-7-9/h3-7,10-11,13H,2,8H2,1H3,(H,14,15) |
| InChIKey | KDXMKBRXZGQGGN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |