C13H18N2O — CID 78268048
2-ethyl-6-methyl-5-phenyl-1,3-diazinan-4-one (PubChem CID 78268048) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-ethyl-6-methyl-5-phenyl-1,3-diazinan-4-one.
| Compound Name | 2-ethyl-6-methyl-5-phenyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78268048 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-ethyl-6-methyl-5-phenyl-1,3-diazinan-4-one |
| SMILES | CCC1NC(=O)C(c2ccccc2)C(C)N1 |
| InChI | InChI=1S/C13H18N2O/c1-3-11-14-9(2)12(13(16)15-11)10-7-5-4-6-8-10/h4-9,11-12,14H,3H2,1-2H3,(H,15,16) |
| InChIKey | PMEZAPWLRDFAIZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |