C19H22N2O — CID 15038927
(2R,3R,6S,7R)-3,6-dimethyl-2,7-diphenyl-1,4-diazepan-5-one (PubChem CID 15038927) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (2R,3R,6S,7R)-3,6-dimethyl-2,7-diphenyl-1,4-diazepan-5-one.
| Compound Name | (2R,3R,6S,7R)-3,6-dimethyl-2,7-diphenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 15038927 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2R,3R,6S,7R)-3,6-dimethyl-2,7-diphenyl-1,4-diazepan-5-one |
| SMILES | C[C@@H]1C(=O)N[C@H](C)[C@@H](c2ccccc2)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-13-17(15-9-5-3-6-10-15)21-18(14(2)20-19(13)22)16-11-7-4-8-12-16/h3-14,17-18,21H,1-2H3,(H,20,22)/t13-,14+,17+,18-/m0/s1 |
| InChIKey | LXELDKCWRBMBFC-JFTQMJAMSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |