C12H15NO — CID 15432500
(3R,4S,5R)-3,5-dimethyl-4-phenylpyrrolidin-2-one (PubChem CID 15432500) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (3R,4S,5R)-3,5-dimethyl-4-phenylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-3,5-dimethyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15432500 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3R,4S,5R)-3,5-dimethyl-4-phenylpyrrolidin-2-one |
| SMILES | C[C@H]1NC(=O)[C@H](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H15NO/c1-8-11(9(2)13-12(8)14)10-6-4-3-5-7-10/h3-9,11H,1-2H3,(H,13,14)/t8-,9-,11-/m1/s1 |
| InChIKey | QLYQZBJMESVXCY-FXPVBKGRSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |