C19H19F2NO — CID 98345871
(2R,3S,5R,6S)-2,6-bis(4-fluorophenyl)-3,5-dimethylpiperidin-4-one (PubChem CID 98345871) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2,6-bis(4-fluorophenyl)-3,5-dimethylpiperidin-4-one.
| Compound Name | (2R,3S,5R,6S)-2,6-bis(4-fluorophenyl)-3,5-dimethylpiperidin-4-one |
|---|---|
| PubChem CID | 98345871 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2R,3S,5R,6S)-2,6-bis(4-fluorophenyl)-3,5-dimethylpiperidin-4-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@@H](c2ccc(F)cc2)N[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2NO/c1-11-17(13-3-7-15(20)8-4-13)22-18(12(2)19(11)23)14-5-9-16(21)10-6-14/h3-12,17-18,22H,1-2H3/t11-,12+,17+,18- |
| InChIKey | ADBLCXKVLSFZLV-KZBLUPIWSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |