C20H23NO — CID 100836349
(2S,3R,6S)-3-methyl-2,6-bis(4-methylphenyl)piperidin-4-one (PubChem CID 100836349) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (2S,3R,6S)-3-methyl-2,6-bis(4-methylphenyl)piperidin-4-one.
| Compound Name | (2S,3R,6S)-3-methyl-2,6-bis(4-methylphenyl)piperidin-4-one |
|---|---|
| PubChem CID | 100836349 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2S,3R,6S)-3-methyl-2,6-bis(4-methylphenyl)piperidin-4-one |
| SMILES | Cc1ccc([C@@H]2CC(=O)[C@H](C)[C@@H](c3ccc(C)cc3)N2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-13-4-8-16(9-5-13)18-12-19(22)15(3)20(21-18)17-10-6-14(2)7-11-17/h4-11,15,18,20-21H,12H2,1-3H3/t15-,18-,20-/m0/s1 |
| InChIKey | CIIGQBBCLUPVRT-QSFXBCCZSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |