C20H23NO3 — CID 7021020
(2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-one (PubChem CID 7021020) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-one.
| Compound Name | (2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-one |
|---|---|
| PubChem CID | 7021020 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (2R,3R,6S)-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-one |
| SMILES | COc1ccc(C2N[C@H](c3ccc(OC)cc3)CC(=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-13-19(22)12-18(14-4-8-16(23-2)9-5-14)21-20(13)15-6-10-17(24-3)11-7-15/h4-11,13,18,20-21H,12H2,1-3H3/t13-,18-,20?/m0/s1 |
| InChIKey | LUPLWIXSMMGDLK-TWRQCCBLSA-N |
| XLogP | 3.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |