C24H34ClNO3 — CID 2854780
4-butyl-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-ol;hydrochloride (PubChem CID 2854780) has the molecular formula C24H34ClNO3 and a molecular weight of 419.99 g/mol. Its IUPAC name is 4-butyl-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-ol;hydrochloride.
| Compound Name | 4-butyl-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 2854780 |
| Molecular Formula | C24H34ClNO3 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-butyl-2,6-bis(4-methoxyphenyl)-3-methylpiperidin-4-ol;hydrochloride |
| SMILES | CCCCC1(O)CC(c2ccc(OC)cc2)NC(c2ccc(OC)cc2)C1C.Cl |
| InChI | InChI=1S/C24H33NO3.ClH/c1-5-6-15-24(26)16-22(18-7-11-20(27-3)12-8-18)25-23(17(24)2)19-9-13-21(28-4)14-10-19;/h7-14,17,22-23,25-26H,5-6,15-16H2,1-4H3;1H |
| InChIKey | RNYLEXXBRGTMNF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |