C30H34ClNO3 — CID 52998404
2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol;hydrochloride (PubChem CID 52998404) has the molecular formula C30H34ClNO3 and a molecular weight of 492.06 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol;hydrochloride.
| Compound Name | 2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 52998404 |
| Molecular Formula | C30H34ClNO3 |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol;hydrochloride |
| SMILES | CCCC1C(c2ccc(OC)cc2)NC(c2ccc(OC)cc2)CC1(O)C#Cc1ccccc1.Cl |
| InChI | InChI=1S/C30H33NO3.ClH/c1-4-8-27-29(24-13-17-26(34-3)18-14-24)31-28(23-11-15-25(33-2)16-12-23)21-30(27,32)20-19-22-9-6-5-7-10-22;/h5-7,9-18,27-29,31-32H,4,8,21H2,1-3H3;1H |
| InChIKey | AKMGPTHHUGYRSF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|