C27H27NO — CID 7108613
(2S,3R,5S,6S)-3,5-dimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-4-ol (PubChem CID 7108613) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S,3R,5S,6S)-3,5-dimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-4-ol.
| Compound Name | (2S,3R,5S,6S)-3,5-dimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-4-ol |
|---|---|
| PubChem CID | 7108613 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (2S,3R,5S,6S)-3,5-dimethyl-2,6-diphenyl-4-(2-phenylethynyl)piperidin-4-ol |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)N[C@H](c2ccccc2)[C@H](C)C1(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C27H27NO/c1-20-25(23-14-8-4-9-15-23)28-26(24-16-10-5-11-17-24)21(2)27(20,29)19-18-22-12-6-3-7-13-22/h3-17,20-21,25-26,28-29H,1-2H3/t20-,21+,25-,26-,27?/m0/s1 |
| InChIKey | JVERHSPATOGMGT-YXGPKXJVSA-N |
| XLogP | 5.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|