C28H33NO3 — CID 7112352
(2S,3S,5R,6R)-4-benzyl-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-4-ol (PubChem CID 7112352) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (2S,3S,5R,6R)-4-benzyl-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-4-ol.
| Compound Name | (2S,3S,5R,6R)-4-benzyl-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 7112352 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (2S,3S,5R,6R)-4-benzyl-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-4-ol |
| SMILES | COc1ccc([C@H]2N[C@@H](c3ccc(OC)cc3)[C@@H](C)C(O)(Cc3ccccc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C28H33NO3/c1-19-26(22-10-14-24(31-3)15-11-22)29-27(23-12-16-25(32-4)17-13-23)20(2)28(19,30)18-21-8-6-5-7-9-21/h5-17,19-20,26-27,29-30H,18H2,1-4H3/t19-,20+,26-,27+,28? |
| InChIKey | BTUTYNXWDXRDAN-WHTOPFKPSA-N |
| XLogP | 5.34 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |