C31H29NO3 — CID 40806325
(2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-diphenylpiperidin-4-one (PubChem CID 40806325) has the molecular formula C31H29NO3 and a molecular weight of 463.58 g/mol. Its IUPAC name is (2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-diphenylpiperidin-4-one.
| Compound Name | (2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-diphenylpiperidin-4-one |
|---|---|
| PubChem CID | 40806325 |
| Molecular Formula | C31H29NO3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-diphenylpiperidin-4-one |
| SMILES | COc1ccc([C@H]2N[C@@H](c3ccc(OC)cc3)[C@@H](c3ccccc3)C(=O)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29NO3/c1-34-25-17-13-23(14-18-25)29-27(21-9-5-3-6-10-21)31(33)28(22-11-7-4-8-12-22)30(32-29)24-15-19-26(35-2)20-16-24/h3-20,27-30,32H,1-2H3/t27-,28+,29+,30- |
| InChIKey | VSSKKPICNJFIMN-LPOKLPNDSA-N |
| XLogP | 6.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |