C18H17BrN2O2 — CID 102339314
(1R,3R,4R,5R)-4-bromo-6-(4-methoxyphenyl)-3-phenyl-2,6-diazabicyclo[3.2.0]heptan-7-one (PubChem CID 102339314) has the molecular formula C18H17BrN2O2 and a molecular weight of 373.25 g/mol. Its IUPAC name is (1R,3R,4R,5R)-4-bromo-6-(4-methoxyphenyl)-3-phenyl-2,6-diazabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1R,3R,4R,5R)-4-bromo-6-(4-methoxyphenyl)-3-phenyl-2,6-diazabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 102339314 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (1R,3R,4R,5R)-4-bromo-6-(4-methoxyphenyl)-3-phenyl-2,6-diazabicyclo[3.2.0]heptan-7-one |
| SMILES | COc1ccc(N2C(=O)[C@@H]3N[C@H](c4ccccc4)[C@@H](Br)[C@@H]32)cc1 |
| InChI | InChI=1S/C18H17BrN2O2/c1-23-13-9-7-12(8-10-13)21-17-14(19)15(20-16(17)18(21)22)11-5-3-2-4-6-11/h2-10,14-17,20H,1H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | ICEZXJJRCRETJA-VQHPVUNQSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|