C20H20INO3 — CID 10003837
(1S,2R,4S,5R,6R)-5-iodo-7-(4-methoxyphenyl)-2-methyl-4-phenyl-3-oxa-7-azabicyclo[4.2.0]octan-8-one (PubChem CID 10003837) has the molecular formula C20H20INO3 and a molecular weight of 449.29 g/mol. Its IUPAC name is (1S,2R,4S,5R,6R)-5-iodo-7-(4-methoxyphenyl)-2-methyl-4-phenyl-3-oxa-7-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (1S,2R,4S,5R,6R)-5-iodo-7-(4-methoxyphenyl)-2-methyl-4-phenyl-3-oxa-7-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 10003837 |
| Molecular Formula | C20H20INO3 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | (1S,2R,4S,5R,6R)-5-iodo-7-(4-methoxyphenyl)-2-methyl-4-phenyl-3-oxa-7-azabicyclo[4.2.0]octan-8-one |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H]2[C@@H](I)[C@H](c2ccccc2)O[C@@H]3C)cc1 |
| InChI | InChI=1S/C20H20INO3/c1-12-16-18(17(21)19(25-12)13-6-4-3-5-7-13)22(20(16)23)14-8-10-15(24-2)11-9-14/h3-12,16-19H,1-2H3/t12-,16-,17-,18-,19+/m1/s1 |
| InChIKey | ZAWJGFKKXXLULW-FXJWEYNDSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|