C24H21NO3 — CID 7311784
(2S)-3-(4-methoxyphenyl)-6-methyl-2,5-diphenyl-2H-1,3-oxazin-4-one (PubChem CID 7311784) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2S)-3-(4-methoxyphenyl)-6-methyl-2,5-diphenyl-2H-1,3-oxazin-4-one.
| Compound Name | (2S)-3-(4-methoxyphenyl)-6-methyl-2,5-diphenyl-2H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 7311784 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2S)-3-(4-methoxyphenyl)-6-methyl-2,5-diphenyl-2H-1,3-oxazin-4-one |
| SMILES | COc1ccc(N2C(=O)C(c3ccccc3)=C(C)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO3/c1-17-22(18-9-5-3-6-10-18)23(26)25(20-13-15-21(27-2)16-14-20)24(28-17)19-11-7-4-8-12-19/h3-16,24H,1-2H3/t24-/m0/s1 |
| InChIKey | AWZDPBRLDOMWSU-DEOSSOPVSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |