C19H17NO2 — CID 101494314
(3Z,4R)-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylideneazetidin-2-one (PubChem CID 101494314) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3Z,4R)-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylideneazetidin-2-one.
| Compound Name | (3Z,4R)-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylideneazetidin-2-one |
|---|---|
| PubChem CID | 101494314 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (3Z,4R)-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylideneazetidin-2-one |
| SMILES | C=C/C=C1\C(=O)N(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H17NO2/c1-3-7-17-18(14-8-5-4-6-9-14)20(19(17)21)15-10-12-16(22-2)13-11-15/h3-13,18H,1H2,2H3/b17-7-/t18-/m1/s1 |
| InChIKey | PRRLXWMMPGSVDE-CTUYBLSSSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|