C29H31N3O3 — CID 154198562
(3E)-3-[2-[3-(benzylamino)propoxyimino]propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one (PubChem CID 154198562) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is (3E)-3-[2-[3-(benzylamino)propoxyimino]propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one.
| Compound Name | (3E)-3-[2-[3-(benzylamino)propoxyimino]propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 154198562 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (3E)-3-[2-[3-(benzylamino)propoxyimino]propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)/C(=C/C(C)=NOCCCNCc3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-22(31-35-19-9-18-30-21-23-10-5-3-6-11-23)20-27-28(24-12-7-4-8-13-24)32(29(27)33)25-14-16-26(34-2)17-15-25/h3-8,10-17,20,28,30H,9,18-19,21H2,1-2H3/b27-20+,31-22? |
| InChIKey | HZTPRHMEADMIDD-JHMAFBPSSA-N |
| XLogP | 5.28 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|