C31H43N3O3 — CID 88611973
(3E)-3-[2-(8-aminododecan-3-yloxyimino)propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one (PubChem CID 88611973) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is (3E)-3-[2-(8-aminododecan-3-yloxyimino)propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one.
| Compound Name | (3E)-3-[2-(8-aminododecan-3-yloxyimino)propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 88611973 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | (3E)-3-[2-(8-aminododecan-3-yloxyimino)propylidene]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
| SMILES | CCCCC(N)CCCCC(CC)ON=C(C)/C=C1/C(=O)N(c2ccc(OC)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C31H43N3O3/c1-5-7-15-25(32)16-11-12-17-27(6-2)37-33-23(3)22-29-30(24-13-9-8-10-14-24)34(31(29)35)26-18-20-28(36-4)21-19-26/h8-10,13-14,18-22,25,27,30H,5-7,11-12,15-17,32H2,1-4H3/b29-22+,33-23? |
| InChIKey | ZOXXGVIPGVEHRL-ZOPDSLHSSA-N |
| XLogP | 6.96 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|