C29H37N3O4 — CID 173388632
methyl 4-[3-[2-[3-(ethylamino)heptoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate (PubChem CID 173388632) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is methyl 4-[3-[2-[3-(ethylamino)heptoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[2-[3-(ethylamino)heptoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate |
|---|---|
| PubChem CID | 173388632 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | methyl 4-[3-[2-[3-(ethylamino)heptoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate |
| SMILES | CCCCC(CCON=C(C)C=C1C(=O)N(c2ccc(C(=O)OC)cc2)C1c1ccccc1)NCC |
| InChI | InChI=1S/C29H37N3O4/c1-5-7-13-24(30-6-2)18-19-36-31-21(3)20-26-27(22-11-9-8-10-12-22)32(28(26)33)25-16-14-23(15-17-25)29(34)35-4/h8-12,14-17,20,24,27,30H,5-7,13,18-19H2,1-4H3 |
| InChIKey | WPEQJFAOYJTYCZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|