C31H41N3O4 — CID 23035647
methyl 4-[(3E)-3-[(2E)-2-[3-(dibutylamino)propoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate (PubChem CID 23035647) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is methyl 4-[(3E)-3-[(2E)-2-[3-(dibutylamino)propoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3E)-3-[(2E)-2-[3-(dibutylamino)propoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23035647 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | methyl 4-[(3E)-3-[(2E)-2-[3-(dibutylamino)propoxyimino]propylidene]-2-oxo-4-phenylazetidin-1-yl]benzoate |
| SMILES | CCCCN(CCCC)CCCO/N=C(C)/C=C1/C(=O)N(c2ccc(C(=O)OC)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C31H41N3O4/c1-5-7-19-33(20-8-6-2)21-12-22-38-32-24(3)23-28-29(25-13-10-9-11-14-25)34(30(28)35)27-17-15-26(16-18-27)31(36)37-4/h9-11,13-18,23,29H,5-8,12,19-22H2,1-4H3/b28-23+,32-24+ |
| InChIKey | GIEUZTIOOCYSKP-XGERQSCOSA-N |
| XLogP | 6.17 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|