C22H23NO5 — CID 54750460
tert-butyl (2R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2-phenyl-2H-pyrrole-3-carboxylate (PubChem CID 54750460) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is tert-butyl (2R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2-phenyl-2H-pyrrole-3-carboxylate.
| Compound Name | tert-butyl (2R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2-phenyl-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54750460 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl (2R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2-phenyl-2H-pyrrole-3-carboxylate |
| SMILES | COc1ccc(N2C(=O)C(O)=C(C(=O)OC(C)(C)C)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-22(2,3)28-21(26)17-18(14-8-6-5-7-9-14)23(20(25)19(17)24)15-10-12-16(27-4)13-11-15/h5-13,18,24H,1-4H3/t18-/m1/s1 |
| InChIKey | UAZSLQYLTGBUCC-GOSISDBHSA-N |
| XLogP | 3.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |