C28H26N2O4 — CID 92847908
(2S)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-(4-methoxyphenyl)-3-[(Z)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 92847908) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is (2S)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-(4-methoxyphenyl)-3-[(Z)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | (2S)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-(4-methoxyphenyl)-3-[(Z)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 92847908 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (2S)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-(4-methoxyphenyl)-3-[(Z)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | COc1ccc(N2C(=O)C(O)=C(C(=O)/C=C\c3ccccc3)[C@@H]2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-29(2)21-12-10-20(11-13-21)26-25(24(31)18-9-19-7-5-4-6-8-19)27(32)28(33)30(26)22-14-16-23(34-3)17-15-22/h4-18,26,32H,1-3H3/b18-9-/t26-/m0/s1 |
| InChIKey | VNKULUGHRDZLJG-ROTUXNKCSA-N |
| XLogP | 4.94 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|