C27H23NO4 — CID 4972723
1-(4-ethoxyphenyl)-4-hydroxy-2-phenyl-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4972723) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-4-hydroxy-2-phenyl-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(4-ethoxyphenyl)-4-hydroxy-2-phenyl-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4972723 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-(4-ethoxyphenyl)-4-hydroxy-2-phenyl-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCOc1ccc(N2C(=O)C(O)=C(C(=O)C=Cc3ccccc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-2-32-22-16-14-21(15-17-22)28-25(20-11-7-4-8-12-20)24(26(30)27(28)31)23(29)18-13-19-9-5-3-6-10-19/h3-18,25,30H,2H2,1H3 |
| InChIKey | QBVIKVKNAFUIKY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|