C22H23NO4 — CID 108594942
2-(4-ethoxyphenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-phenyl-2H-pyrrol-5-one (PubChem CID 108594942) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-phenyl-2H-pyrrol-5-one.
| Compound Name | 2-(4-ethoxyphenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108594942 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-(4-ethoxyphenyl)-4-hydroxy-3-(2-methylpropanoyl)-1-phenyl-2H-pyrrol-5-one |
| SMILES | CCOc1ccc(C2C(C(=O)C(C)C)=C(O)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO4/c1-4-27-17-12-10-15(11-13-17)19-18(20(24)14(2)3)21(25)22(26)23(19)16-8-6-5-7-9-16/h5-14,19,25H,4H2,1-3H3 |
| InChIKey | QNLCLIOCDXGUCZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |