C26H20INO5 — CID 94482968
(2S)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 94482968) has the molecular formula C26H20INO5 and a molecular weight of 553.35 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | (2S)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 94482968 |
| Molecular Formula | C26H20INO5 |
| Molecular Weight | 553.35 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | (2S)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(4-iodophenyl)-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | COc1cc([C@H]2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2ccc(I)cc2)ccc1O |
| InChI | InChI=1S/C26H20INO5/c1-33-22-15-17(8-14-20(22)29)24-23(21(30)13-7-16-5-3-2-4-6-16)25(31)26(32)28(24)19-11-9-18(27)10-12-19/h2-15,24,29,31H,1H3/b13-7+/t24-/m0/s1 |
| InChIKey | YLOTVTIMTLLIML-DEZWEULXSA-N |
| XLogP | 5.19 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|