C24H23NO7 — CID 3134087
4-[4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]butanoic acid (PubChem CID 3134087) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is 4-[4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]butanoic acid.
| Compound Name | 4-[4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 3134087 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]butanoic acid |
| SMILES | COc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2CCCC(=O)O)ccc1O |
| InChI | InChI=1S/C24H23NO7/c1-32-19-14-16(10-12-17(19)26)22-21(18(27)11-9-15-6-3-2-4-7-15)23(30)24(31)25(22)13-5-8-20(28)29/h2-4,6-7,9-12,14,22,26,30H,5,8,13H2,1H3,(H,28,29) |
| InChIKey | XKLSBSJNVDYNNZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|