C27H32N2O5 — CID 6189797
1-[3-(dimethylamino)propyl]-2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189797) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-[3-(dimethylamino)propyl]-2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189797 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | CCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2CCCN(C)C)cc1OC |
| InChI | InChI=1S/C27H32N2O5/c1-5-34-22-15-13-20(18-23(22)33-4)25-24(21(30)14-12-19-10-7-6-8-11-19)26(31)27(32)29(25)17-9-16-28(2)3/h6-8,10-15,18,25,31H,5,9,16-17H2,1-4H3/b14-12+ |
| InChIKey | GCURGXHJZQLYAU-WYMLVPIESA-N |
| XLogP | 4.02 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|