C36H33NO5 — CID 4697628
2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4697628) has the molecular formula C36H33NO5 and a molecular weight of 559.66 g/mol. Its IUPAC name is 2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697628 |
| Molecular Formula | C36H33NO5 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCOc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2CCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H33NO5/c1-2-41-32-24-29(19-21-31(32)42-25-28-16-10-5-11-17-28)34-33(30(38)20-18-26-12-6-3-7-13-26)35(39)36(40)37(34)23-22-27-14-8-4-9-15-27/h3-21,24,34,39H,2,22-23,25H2,1H3 |
| InChIKey | CMXOROIJMLFILU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|