C29H34N2O5 — CID 6189829
1-[3-(dimethylamino)propyl]-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189829) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-[3-(dimethylamino)propyl]-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189829 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2CCCN(C)C)cc1OCC |
| InChI | InChI=1S/C29H34N2O5/c1-5-19-36-24-16-14-22(20-25(24)35-6-2)27-26(23(32)15-13-21-11-8-7-9-12-21)28(33)29(34)31(27)18-10-17-30(3)4/h5,7-9,11-16,20,27,33H,1,6,10,17-19H2,2-4H3/b15-13+ |
| InChIKey | RMCGSITUEZXGAR-FYWRMAATSA-N |
| XLogP | 4.58 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|