C30H37NO6 — CID 4697187
2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-hydroxy-1-(3-methoxypropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4697187) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-hydroxy-1-(3-methoxypropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-hydroxy-1-(3-methoxypropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697187 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-hydroxy-1-(3-methoxypropyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCOc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2CCCOC)ccc1OCCC(C)C |
| InChI | InChI=1S/C30H37NO6/c1-5-36-26-20-23(13-15-25(26)37-19-16-21(2)3)28-27(24(32)14-12-22-10-7-6-8-11-22)29(33)30(34)31(28)17-9-18-35-4/h6-8,10-15,20-21,28,33H,5,9,16-19H2,1-4H3 |
| InChIKey | NJTMJBIPAHBDBS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|